C22H25ClN6O2 — CID 134276716
5-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]-1H-imidazole-2-carboxamide (PubChem CID 134276716) has the molecular formula C22H25ClN6O2 and a molecular weight of 440.94 g/mol. Its IUPAC name is 5-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]-1H-imidazole-2-carboxamide.
| Compound Name | 5-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 134276716 |
| Molecular Formula | C22H25ClN6O2 |
| Molecular Weight | 440.94 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 5-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]-1H-imidazole-2-carboxamide |
| SMILES | CCN(CC)CC(O)CNC(=O)c1ncc(C#Cc2c(N)ncc3ccc(Cl)cc23)[nH]1 |
| InChI | InChI=1S/C22H25ClN6O2/c1-3-29(4-2)13-17(30)12-27-22(31)21-26-11-16(28-21)7-8-18-19-9-15(23)6-5-14(19)10-25-20(18)24/h5-6,9-11,17,30H,3-4,12-13H2,1-2H3,(H2,24,25)(H,26,28)(H,27,31) |
| InChIKey | MOOUUULVVNVOEU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.94 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|