C28H30N6O2 — CID 134276930
4-[2-[3-amino-7-(1H-pyrazol-5-yl)isoquinolin-4-yl]ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]benzamide (PubChem CID 134276930) has the molecular formula C28H30N6O2 and a molecular weight of 482.59 g/mol. Its IUPAC name is 4-[2-[3-amino-7-(1H-pyrazol-5-yl)isoquinolin-4-yl]ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]benzamide.
| Compound Name | 4-[2-[3-amino-7-(1H-pyrazol-5-yl)isoquinolin-4-yl]ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]benzamide |
|---|---|
| PubChem CID | 134276930 |
| Molecular Formula | C28H30N6O2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 4-[2-[3-amino-7-(1H-pyrazol-5-yl)isoquinolin-4-yl]ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]benzamide |
| SMILES | CCN(CC)CC(O)CNC(=O)c1ccc(C#Cc2c(N)ncc3cc(-c4ccn[nH]4)ccc23)cc1 |
| InChI | InChI=1S/C28H30N6O2/c1-3-34(4-2)18-23(35)17-31-28(36)20-8-5-19(6-9-20)7-11-25-24-12-10-21(26-13-14-32-33-26)15-22(24)16-30-27(25)29/h5-6,8-10,12-16,23,35H,3-4,17-18H2,1-2H3,(H2,29,30)(H,31,36)(H,32,33) |
| InChIKey | OTRFYZDUCOJBIH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|