C31H32N4O2 — CID 158910289
1-[4-[2-(3-amino-7-pyridin-4-ylisoquinolin-4-yl)ethynyl]phenyl]-5-(diethylamino)-4-hydroxypentan-1-one (PubChem CID 158910289) has the molecular formula C31H32N4O2 and a molecular weight of 492.62 g/mol. Its IUPAC name is 1-[4-[2-(3-amino-7-pyridin-4-ylisoquinolin-4-yl)ethynyl]phenyl]-5-(diethylamino)-4-hydroxypentan-1-one.
| Compound Name | 1-[4-[2-(3-amino-7-pyridin-4-ylisoquinolin-4-yl)ethynyl]phenyl]-5-(diethylamino)-4-hydroxypentan-1-one |
|---|---|
| PubChem CID | 158910289 |
| Molecular Formula | C31H32N4O2 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 1-[4-[2-(3-amino-7-pyridin-4-ylisoquinolin-4-yl)ethynyl]phenyl]-5-(diethylamino)-4-hydroxypentan-1-one |
| SMILES | CCN(CC)CC(O)CCC(=O)c1ccc(C#Cc2c(N)ncc3cc(-c4ccncc4)ccc23)cc1 |
| InChI | InChI=1S/C31H32N4O2/c1-3-35(4-2)21-27(36)11-14-30(37)24-8-5-22(6-9-24)7-12-29-28-13-10-25(23-15-17-33-18-16-23)19-26(28)20-34-31(29)32/h5-6,8-10,13,15-20,27,36H,3-4,11,14,21H2,1-2H3,(H2,32,34) |
| InChIKey | HZYZECRNIQDQGQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|