C26H31N5O4 — CID 159744608
1-[4-[2-(7-amino-2,3-dimethoxypyrido[3,4-b]pyrazin-8-yl)ethynyl]phenyl]-5-(diethylamino)-4-hydroxypentan-1-one (PubChem CID 159744608) has the molecular formula C26H31N5O4 and a molecular weight of 477.57 g/mol. Its IUPAC name is 1-[4-[2-(7-amino-2,3-dimethoxypyrido[3,4-b]pyrazin-8-yl)ethynyl]phenyl]-5-(diethylamino)-4-hydroxypentan-1-one.
| Compound Name | 1-[4-[2-(7-amino-2,3-dimethoxypyrido[3,4-b]pyrazin-8-yl)ethynyl]phenyl]-5-(diethylamino)-4-hydroxypentan-1-one |
|---|---|
| PubChem CID | 159744608 |
| Molecular Formula | C26H31N5O4 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 1-[4-[2-(7-amino-2,3-dimethoxypyrido[3,4-b]pyrazin-8-yl)ethynyl]phenyl]-5-(diethylamino)-4-hydroxypentan-1-one |
| SMILES | CCN(CC)CC(O)CCC(=O)c1ccc(C#Cc2c(N)ncc3nc(OC)c(OC)nc23)cc1 |
| InChI | InChI=1S/C26H31N5O4/c1-5-31(6-2)16-19(32)12-14-22(33)18-10-7-17(8-11-18)9-13-20-23-21(15-28-24(20)27)29-25(34-3)26(30-23)35-4/h7-8,10-11,15,19,32H,5-6,12,14,16H2,1-4H3,(H2,27,28) |
| InChIKey | QQLDCZAXUMRIIF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|