C29H31N3O2 — CID 159648956
1-[4-[2-(3-amino-9H-indeno[2,1-c]pyridin-4-yl)ethynyl]phenyl]-5-(diethylamino)-4-hydroxypentan-1-one (PubChem CID 159648956) has the molecular formula C29H31N3O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 1-[4-[2-(3-amino-9H-indeno[2,1-c]pyridin-4-yl)ethynyl]phenyl]-5-(diethylamino)-4-hydroxypentan-1-one.
| Compound Name | 1-[4-[2-(3-amino-9H-indeno[2,1-c]pyridin-4-yl)ethynyl]phenyl]-5-(diethylamino)-4-hydroxypentan-1-one |
|---|---|
| PubChem CID | 159648956 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 1-[4-[2-(3-amino-9H-indeno[2,1-c]pyridin-4-yl)ethynyl]phenyl]-5-(diethylamino)-4-hydroxypentan-1-one |
| SMILES | CCN(CC)CC(O)CCC(=O)c1ccc(C#Cc2c(N)ncc3c2-c2ccccc2C3)cc1 |
| InChI | InChI=1S/C29H31N3O2/c1-3-32(4-2)19-24(33)14-16-27(34)21-12-9-20(10-13-21)11-15-26-28-23(18-31-29(26)30)17-22-7-5-6-8-25(22)28/h5-10,12-13,18,24,33H,3-4,14,16-17,19H2,1-2H3,(H2,30,31) |
| InChIKey | CMIFUDKTYXHKEC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|