C29H30N4O2 — CID 161093021
1-[4-[2-[2-amino-4-(2-pyridin-2-ylethynyl)-3-pyridinyl]ethynyl]phenyl]-5-(diethylamino)-4-hydroxypentan-1-one (PubChem CID 161093021) has the molecular formula C29H30N4O2 and a molecular weight of 466.59 g/mol. Its IUPAC name is 1-[4-[2-[2-amino-4-(2-pyridin-2-ylethynyl)-3-pyridinyl]ethynyl]phenyl]-5-(diethylamino)-4-hydroxypentan-1-one.
| Compound Name | 1-[4-[2-[2-amino-4-(2-pyridin-2-ylethynyl)-3-pyridinyl]ethynyl]phenyl]-5-(diethylamino)-4-hydroxypentan-1-one |
|---|---|
| PubChem CID | 161093021 |
| Molecular Formula | C29H30N4O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 1-[4-[2-[2-amino-4-(2-pyridin-2-ylethynyl)-3-pyridinyl]ethynyl]phenyl]-5-(diethylamino)-4-hydroxypentan-1-one |
| SMILES | CCN(CC)CC(O)CCC(=O)c1ccc(C#Cc2c(C#Cc3ccccn3)ccnc2N)cc1 |
| InChI | InChI=1S/C29H30N4O2/c1-3-33(4-2)21-26(34)15-17-28(35)24-11-8-22(9-12-24)10-16-27-23(18-20-32-29(27)30)13-14-25-7-5-6-19-31-25/h5-9,11-12,18-20,26,34H,3-4,15,17,21H2,1-2H3,(H2,30,32) |
| InChIKey | BRZCTPNCTCQAMC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|