C22H20N2O3 — CID 147112582
(3S)-3-[(1R)-1-aminoethyl]-5-hydroxy-1-[4-(4-pyridin-2-ylbuta-1,3-diynyl)phenyl]pentane-1,4-dione (PubChem CID 147112582) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is (3S)-3-[(1R)-1-aminoethyl]-5-hydroxy-1-[4-(4-pyridin-2-ylbuta-1,3-diynyl)phenyl]pentane-1,4-dione.
| Compound Name | (3S)-3-[(1R)-1-aminoethyl]-5-hydroxy-1-[4-(4-pyridin-2-ylbuta-1,3-diynyl)phenyl]pentane-1,4-dione |
|---|---|
| PubChem CID | 147112582 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (3S)-3-[(1R)-1-aminoethyl]-5-hydroxy-1-[4-(4-pyridin-2-ylbuta-1,3-diynyl)phenyl]pentane-1,4-dione |
| SMILES | C[C@@H](N)C(CC(=O)c1ccc(C#CC#Cc2ccccn2)cc1)C(=O)CO |
| InChI | InChI=1S/C22H20N2O3/c1-16(23)20(22(27)15-25)14-21(26)18-11-9-17(10-12-18)6-2-3-7-19-8-4-5-13-24-19/h4-5,8-13,16,20,25H,14-15,23H2,1H3/t16-,20?/m1/s1 |
| InChIKey | BMUHPTRQPHRDRT-QRIPLOBPSA-N |
| XLogP | 1.58 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|