C23H30N4O3 — CID 134277070
4-[2-(2-amino-4-ethoxy-3-pyridinyl)ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]benzamide (PubChem CID 134277070) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 4-[2-(2-amino-4-ethoxy-3-pyridinyl)ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]benzamide.
| Compound Name | 4-[2-(2-amino-4-ethoxy-3-pyridinyl)ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]benzamide |
|---|---|
| PubChem CID | 134277070 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 4-[2-(2-amino-4-ethoxy-3-pyridinyl)ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]benzamide |
| SMILES | CCOc1ccnc(N)c1C#Cc1ccc(C(=O)NCC(O)CN(CC)CC)cc1 |
| InChI | InChI=1S/C23H30N4O3/c1-4-27(5-2)16-19(28)15-26-23(29)18-10-7-17(8-11-18)9-12-20-21(30-6-3)13-14-25-22(20)24/h7-8,10-11,13-14,19,28H,4-6,15-16H2,1-3H3,(H2,24,25)(H,26,29) |
| InChIKey | HPUPDEKZVNBPTB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|