C25H29ClN6O3 — CID 142291148
[4-[[3-(diethylamino)-2-hydroxypropyl]carbamoyl]benzenecarboximidoyl] 3-amino-6-chloroisoquinoline-4-carboximidate (PubChem CID 142291148) has the molecular formula C25H29ClN6O3 and a molecular weight of 497.00 g/mol. Its IUPAC name is [4-[[3-(diethylamino)-2-hydroxypropyl]carbamoyl]benzenecarboximidoyl] 3-amino-6-chloroisoquinoline-4-carboximidate.
| Compound Name | [4-[[3-(diethylamino)-2-hydroxypropyl]carbamoyl]benzenecarboximidoyl] 3-amino-6-chloroisoquinoline-4-carboximidate |
|---|---|
| PubChem CID | 142291148 |
| Molecular Formula | C25H29ClN6O3 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | [4-[[3-(diethylamino)-2-hydroxypropyl]carbamoyl]benzenecarboximidoyl] 3-amino-6-chloroisoquinoline-4-carboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])c1ccc(C(=O)NCC(O)CN(CC)CC)cc1)c1c(N)ncc2ccc(Cl)cc12 |
| InChI | InChI=1S/C25H29ClN6O3/c1-3-32(4-2)14-19(33)13-31-25(34)16-7-5-15(6-8-16)23(28)35-24(29)21-20-11-18(26)10-9-17(20)12-30-22(21)27/h5-12,19,28-29,33H,3-4,13-14H2,1-2H3,(H2,27,30)(H,31,34)/b28-23+,29-24- |
| InChIKey | KOZPQPZSCZSHKZ-ABHBNJMISA-N |
| XLogP | 3.27 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|