C27H33ClN4O2 — CID 167104071
(3Z)-5-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]-6-methyl-2-methylidenehepta-3,5-dienamide (PubChem CID 167104071) has the molecular formula C27H33ClN4O2 and a molecular weight of 481.04 g/mol. Its IUPAC name is (3Z)-5-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]-6-methyl-2-methylidenehepta-3,5-dienamide.
| Compound Name | (3Z)-5-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]-6-methyl-2-methylidenehepta-3,5-dienamide |
|---|---|
| PubChem CID | 167104071 |
| Molecular Formula | C27H33ClN4O2 |
| Molecular Weight | 481.04 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | (3Z)-5-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]-6-methyl-2-methylidenehepta-3,5-dienamide |
| SMILES | C=C(/C=C\C(C#Cc1c(N)ncc2ccc(Cl)cc12)=C(C)C)C(=O)NCC(O)CN(CC)CC |
| InChI | InChI=1S/C27H33ClN4O2/c1-6-32(7-2)17-23(33)16-31-27(34)19(5)8-9-20(18(3)4)11-13-24-25-14-22(28)12-10-21(25)15-30-26(24)29/h8-10,12,14-15,23,33H,5-7,16-17H2,1-4H3,(H2,29,30)(H,31,34)/b9-8- |
| InChIKey | IQOXCZPFSXSULE-HJWRWDBZSA-N |
| XLogP | 4.09 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.04 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|