C24H24ClN5O3 — CID 142291188
4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[3-(dimethylcarbamoylamino)-2-hydroxypropyl]benzamide (PubChem CID 142291188) has the molecular formula C24H24ClN5O3 and a molecular weight of 465.94 g/mol. Its IUPAC name is 4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[3-(dimethylcarbamoylamino)-2-hydroxypropyl]benzamide.
| Compound Name | 4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[3-(dimethylcarbamoylamino)-2-hydroxypropyl]benzamide |
|---|---|
| PubChem CID | 142291188 |
| Molecular Formula | C24H24ClN5O3 |
| Molecular Weight | 465.94 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[3-(dimethylcarbamoylamino)-2-hydroxypropyl]benzamide |
| SMILES | CN(C)C(=O)NCC(O)CNC(=O)c1ccc(C#Cc2c(N)ncc3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C24H24ClN5O3/c1-30(2)24(33)29-14-19(31)13-28-23(32)16-6-3-15(4-7-16)5-10-20-21-11-18(25)9-8-17(21)12-27-22(20)26/h3-4,6-9,11-12,19,31H,13-14H2,1-2H3,(H2,26,27)(H,28,32)(H,29,33) |
| InChIKey | UNPDCSXKYBTNNP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.94 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|