C21H20ClN4O+ — CID 149205858
3-[[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]benzoyl]amino]propylazanium (PubChem CID 149205858) has the molecular formula C21H20ClN4O+ and a molecular weight of 379.87 g/mol. Its IUPAC name is 3-[[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]benzoyl]amino]propylazanium.
| Compound Name | 3-[[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]benzoyl]amino]propylazanium |
|---|---|
| PubChem CID | 149205858 |
| Molecular Formula | C21H20ClN4O+ |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 3-[[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]benzoyl]amino]propylazanium |
| SMILES | Nc1ncc2ccc(Cl)cc2c1C#Cc1ccc(C(=O)NCCC[NH3+])cc1 |
| InChI | InChI=1S/C21H19ClN4O/c22-17-8-7-16-13-26-20(24)18(19(16)12-17)9-4-14-2-5-15(6-3-14)21(27)25-11-1-10-23/h2-3,5-8,12-13H,1,10-11,23H2,(H2,24,26)(H,25,27)/p+1 |
| InChIKey | XFPBERUJNVLYIR-UHFFFAOYSA-O |
| XLogP | 2.23 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|