C30H34ClN5O3 — CID 134276863
tert-butyl 4-[3-[[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]benzoyl]amino]propyl]piperazine-1-carboxylate (PubChem CID 134276863) has the molecular formula C30H34ClN5O3 and a molecular weight of 548.09 g/mol. Its IUPAC name is tert-butyl 4-[3-[[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]benzoyl]amino]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]benzoyl]amino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 134276863 |
| Molecular Formula | C30H34ClN5O3 |
| Molecular Weight | 548.09 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | tert-butyl 4-[3-[[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]benzoyl]amino]propyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCCNC(=O)c2ccc(C#Cc3c(N)ncc4ccc(Cl)cc34)cc2)CC1 |
| InChI | InChI=1S/C30H34ClN5O3/c1-30(2,3)39-29(38)36-17-15-35(16-18-36)14-4-13-33-28(37)22-8-5-21(6-9-22)7-12-25-26-19-24(31)11-10-23(26)20-34-27(25)32/h5-6,8-11,19-20H,4,13-18H2,1-3H3,(H2,32,34)(H,33,37) |
| InChIKey | LNDVJSSRINTEKC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.09 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|