C32H36N4O — CID 138724568
4-[2-(3-amino-6-hex-1-ynylisoquinolin-4-yl)ethynyl]-N-(3-piperidin-1-ylpropyl)benzamide (PubChem CID 138724568) has the molecular formula C32H36N4O and a molecular weight of 492.67 g/mol. Its IUPAC name is 4-[2-(3-amino-6-hex-1-ynylisoquinolin-4-yl)ethynyl]-N-(3-piperidin-1-ylpropyl)benzamide.
| Compound Name | 4-[2-(3-amino-6-hex-1-ynylisoquinolin-4-yl)ethynyl]-N-(3-piperidin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 138724568 |
| Molecular Formula | C32H36N4O |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | 4-[2-(3-amino-6-hex-1-ynylisoquinolin-4-yl)ethynyl]-N-(3-piperidin-1-ylpropyl)benzamide |
| SMILES | CCCCC#Cc1ccc2cnc(N)c(C#Cc3ccc(C(=O)NCCCN4CCCCC4)cc3)c2c1 |
| InChI | InChI=1S/C32H36N4O/c1-2-3-4-6-10-26-13-17-28-24-35-31(33)29(30(28)23-26)18-14-25-11-15-27(16-12-25)32(37)34-19-9-22-36-20-7-5-8-21-36/h11-13,15-17,23-24H,2-5,7-9,19-22H2,1H3,(H2,33,35)(H,34,37) |
| InChIKey | IREWNROLXMHTJX-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|