C28H28N4O — CID 161483715
3-amino-4-[2-[4-(5-piperidin-1-ylpentanoyl)phenyl]ethynyl]isoquinoline-6-carbonitrile (PubChem CID 161483715) has the molecular formula C28H28N4O and a molecular weight of 436.56 g/mol. Its IUPAC name is 3-amino-4-[2-[4-(5-piperidin-1-ylpentanoyl)phenyl]ethynyl]isoquinoline-6-carbonitrile.
| Compound Name | 3-amino-4-[2-[4-(5-piperidin-1-ylpentanoyl)phenyl]ethynyl]isoquinoline-6-carbonitrile |
|---|---|
| PubChem CID | 161483715 |
| Molecular Formula | C28H28N4O |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 3-amino-4-[2-[4-(5-piperidin-1-ylpentanoyl)phenyl]ethynyl]isoquinoline-6-carbonitrile |
| SMILES | N#Cc1ccc2cnc(N)c(C#Cc3ccc(C(=O)CCCCN4CCCCC4)cc3)c2c1 |
| InChI | InChI=1S/C28H28N4O/c29-19-22-9-13-24-20-31-28(30)25(26(24)18-22)14-10-21-7-11-23(12-8-21)27(33)6-2-5-17-32-15-3-1-4-16-32/h7-9,11-13,18,20H,1-6,15-17H2,(H2,30,31) |
| InChIKey | CENGOYFOJDBMNE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|