C26H25ClN4O — CID 158797792
1-[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]phenyl]-6-(4,5-dihydro-1H-imidazol-2-yl)hexan-1-one (PubChem CID 158797792) has the molecular formula C26H25ClN4O and a molecular weight of 444.97 g/mol. Its IUPAC name is 1-[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]phenyl]-6-(4,5-dihydro-1H-imidazol-2-yl)hexan-1-one.
| Compound Name | 1-[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]phenyl]-6-(4,5-dihydro-1H-imidazol-2-yl)hexan-1-one |
|---|---|
| PubChem CID | 158797792 |
| Molecular Formula | C26H25ClN4O |
| Molecular Weight | 444.97 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 1-[4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]phenyl]-6-(4,5-dihydro-1H-imidazol-2-yl)hexan-1-one |
| SMILES | Nc1ncc2ccc(Cl)cc2c1C#Cc1ccc(C(=O)CCCCCC2=NCCN2)cc1 |
| InChI | InChI=1S/C26H25ClN4O/c27-21-12-11-20-17-31-26(28)22(23(20)16-21)13-8-18-6-9-19(10-7-18)24(32)4-2-1-3-5-25-29-14-15-30-25/h6-7,9-12,16-17H,1-5,14-15H2,(H2,28,31)(H,29,30) |
| InChIKey | CAGYHOSZZLHJJU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.97 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|