C19H17ClN4OS — CID 161267017
4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N'-hydroxybenzenecarboximidamide;methanethiol (PubChem CID 161267017) has the molecular formula C19H17ClN4OS and a molecular weight of 384.89 g/mol. Its IUPAC name is 4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N'-hydroxybenzenecarboximidamide;methanethiol.
| Compound Name | 4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N'-hydroxybenzenecarboximidamide;methanethiol |
|---|---|
| PubChem CID | 161267017 |
| Molecular Formula | C19H17ClN4OS |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 4-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N'-hydroxybenzenecarboximidamide;methanethiol |
| SMILES | CS.NC(=NO)c1ccc(C#Cc2c(N)ncc3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C18H13ClN4O.CH4S/c19-14-7-6-13-10-22-18(21)15(16(13)9-14)8-3-11-1-4-12(5-2-11)17(20)23-24;1-2/h1-2,4-7,9-10,24H,(H2,20,23)(H2,21,22);2H,1H3 |
| InChIKey | VDHXVBCDRCODAU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|