C25H27ClN6O — CID 138724496
2-(3-amino-6-chloroisoquinolin-4-yl)-N-(3-piperidin-1-ylpropyl)-3H-benzimidazole-5-carboxamide (PubChem CID 138724496) has the molecular formula C25H27ClN6O and a molecular weight of 462.99 g/mol. Its IUPAC name is 2-(3-amino-6-chloroisoquinolin-4-yl)-N-(3-piperidin-1-ylpropyl)-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-(3-amino-6-chloroisoquinolin-4-yl)-N-(3-piperidin-1-ylpropyl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 138724496 |
| Molecular Formula | C25H27ClN6O |
| Molecular Weight | 462.99 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 2-(3-amino-6-chloroisoquinolin-4-yl)-N-(3-piperidin-1-ylpropyl)-3H-benzimidazole-5-carboxamide |
| SMILES | Nc1ncc2ccc(Cl)cc2c1-c1nc2ccc(C(=O)NCCCN3CCCCC3)cc2[nH]1 |
| InChI | InChI=1S/C25H27ClN6O/c26-18-7-5-17-15-29-23(27)22(19(17)14-18)24-30-20-8-6-16(13-21(20)31-24)25(33)28-9-4-12-32-10-2-1-3-11-32/h5-8,13-15H,1-4,9-12H2,(H2,27,29)(H,28,33)(H,30,31) |
| InChIKey | JQJJOICPTCGRON-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.99 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|