C37H44N12O2 — CID 138618137
2-[4-[6-[2-[4-(2-azidoethyl)piperazin-1-yl]ethylcarbamoyl]-1H-benzimidazol-2-yl]phenyl]-N-(2-piperidin-1-ylethyl)-3H-benzimidazole-5-carboxamide (PubChem CID 138618137) has the molecular formula C37H44N12O2 and a molecular weight of 688.84 g/mol. Its IUPAC name is 2-[4-[6-[2-[4-(2-azidoethyl)piperazin-1-yl]ethylcarbamoyl]-1H-benzimidazol-2-yl]phenyl]-N-(2-piperidin-1-ylethyl)-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[4-[6-[2-[4-(2-azidoethyl)piperazin-1-yl]ethylcarbamoyl]-1H-benzimidazol-2-yl]phenyl]-N-(2-piperidin-1-ylethyl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 138618137 |
| Molecular Formula | C37H44N12O2 |
| Molecular Weight | 688.84 g/mol |
| Exact Mass | 688.37 |
| IUPAC Name | 2-[4-[6-[2-[4-(2-azidoethyl)piperazin-1-yl]ethylcarbamoyl]-1H-benzimidazol-2-yl]phenyl]-N-(2-piperidin-1-ylethyl)-3H-benzimidazole-5-carboxamide |
| SMILES | [N-]=[N+]=NCCN1CCN(CCNC(=O)c2ccc3nc(-c4ccc(-c5nc6ccc(C(=O)NCCN7CCCCC7)cc6[nH]5)cc4)[nH]c3c2)CC1 |
| InChI | InChI=1S/C37H44N12O2/c38-46-41-14-19-49-22-20-48(21-23-49)18-13-40-37(51)29-9-11-31-33(25-29)45-35(43-31)27-6-4-26(5-7-27)34-42-30-10-8-28(24-32(30)44-34)36(50)39-12-17-47-15-2-1-3-16-47/h4-11,24-25H,1-3,12-23H2,(H,39,50)(H,40,51)(H,42,44)(H,43,45) |
| InChIKey | JIQYLPXWLKZEEG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 174.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.84 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|