C23H25ClN6O2 — CID 134276935
2-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]pyrimidine-5-carboxamide (PubChem CID 134276935) has the molecular formula C23H25ClN6O2 and a molecular weight of 452.95 g/mol. Its IUPAC name is 2-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]pyrimidine-5-carboxamide.
| Compound Name | 2-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 134276935 |
| Molecular Formula | C23H25ClN6O2 |
| Molecular Weight | 452.95 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 2-[2-(3-amino-6-chloroisoquinolin-4-yl)ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]pyrimidine-5-carboxamide |
| SMILES | CCN(CC)CC(O)CNC(=O)c1cnc(C#Cc2c(N)ncc3ccc(Cl)cc23)nc1 |
| InChI | InChI=1S/C23H25ClN6O2/c1-3-30(4-2)14-18(31)13-29-23(32)16-11-26-21(27-12-16)8-7-19-20-9-17(24)6-5-15(20)10-28-22(19)25/h5-6,9-12,18,31H,3-4,13-14H2,1-2H3,(H2,25,28)(H,29,32) |
| InChIKey | WEFMHECZIWRAJK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.95 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|