C26H30N4O3 — CID 134276810
4-[2-(3-amino-6-methoxyisoquinolin-4-yl)ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]benzamide (PubChem CID 134276810) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is 4-[2-(3-amino-6-methoxyisoquinolin-4-yl)ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]benzamide.
| Compound Name | 4-[2-(3-amino-6-methoxyisoquinolin-4-yl)ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]benzamide |
|---|---|
| PubChem CID | 134276810 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 4-[2-(3-amino-6-methoxyisoquinolin-4-yl)ethynyl]-N-[3-(diethylamino)-2-hydroxypropyl]benzamide |
| SMILES | CCN(CC)CC(O)CNC(=O)c1ccc(C#Cc2c(N)ncc3ccc(OC)cc23)cc1 |
| InChI | InChI=1S/C26H30N4O3/c1-4-30(5-2)17-21(31)16-29-26(32)19-9-6-18(7-10-19)8-13-23-24-14-22(33-3)12-11-20(24)15-28-25(23)27/h6-7,9-12,14-15,21,31H,4-5,16-17H2,1-3H3,(H2,27,28)(H,29,32) |
| InChIKey | FXEYFNXZOSDSPR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|