C35H41N5O5 — CID 160537649
N-[3-[3-amino-4-[2-[4-[5-(diethylamino)-4-hydroxypentanoyl]phenyl]ethynyl]isoquinolin-6-yl]prop-2-ynyl]-N'-hydroxyhexanediamide (PubChem CID 160537649) has the molecular formula C35H41N5O5 and a molecular weight of 611.74 g/mol. Its IUPAC name is N-[3-[3-amino-4-[2-[4-[5-(diethylamino)-4-hydroxypentanoyl]phenyl]ethynyl]isoquinolin-6-yl]prop-2-ynyl]-N'-hydroxyhexanediamide.
| Compound Name | N-[3-[3-amino-4-[2-[4-[5-(diethylamino)-4-hydroxypentanoyl]phenyl]ethynyl]isoquinolin-6-yl]prop-2-ynyl]-N'-hydroxyhexanediamide |
|---|---|
| PubChem CID | 160537649 |
| Molecular Formula | C35H41N5O5 |
| Molecular Weight | 611.74 g/mol |
| Exact Mass | 611.31 |
| IUPAC Name | N-[3-[3-amino-4-[2-[4-[5-(diethylamino)-4-hydroxypentanoyl]phenyl]ethynyl]isoquinolin-6-yl]prop-2-ynyl]-N'-hydroxyhexanediamide |
| SMILES | CCN(CC)CC(O)CCC(=O)c1ccc(C#Cc2c(N)ncc3ccc(C#CCNC(=O)CCCCC(=O)NO)cc23)cc1 |
| InChI | InChI=1S/C35H41N5O5/c1-3-40(4-2)24-29(41)18-20-32(42)27-15-11-25(12-16-27)14-19-30-31-22-26(13-17-28(31)23-38-35(30)36)8-7-21-37-33(43)9-5-6-10-34(44)39-45/h11-13,15-17,22-23,29,41,45H,3-6,9-10,18,20-21,24H2,1-2H3,(H2,36,38)(H,37,43)(H,39,44) |
| InChIKey | ULEJMOQAGCWYLK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 157.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.74 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|