C19H21N5 — CID 142291206
(1Z,3Z)-2-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethynyl]-3-ethenyl-4-hydrazinylhexa-1,3,5-trien-1-amine (PubChem CID 142291206) has the molecular formula C19H21N5 and a molecular weight of 319.41 g/mol. Its IUPAC name is (1Z,3Z)-2-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethynyl]-3-ethenyl-4-hydrazinylhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-2-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethynyl]-3-ethenyl-4-hydrazinylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 142291206 |
| Molecular Formula | C19H21N5 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | (1Z,3Z)-2-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethynyl]-3-ethenyl-4-hydrazinylhexa-1,3,5-trien-1-amine |
| SMILES | C=C/C(NN)=C(C=C)/C(C#Cc1ccc(C2=NCCN2)cc1)=C\N |
| InChI | InChI=1S/C19H21N5/c1-3-17(18(4-2)24-21)16(13-20)10-7-14-5-8-15(9-6-14)19-22-11-12-23-19/h3-6,8-9,13,24H,1-2,11-12,20-21H2,(H,22,23)/b16-13-,18-17- |
| InChIKey | JSYFFDTVNYRLIH-JUIIQYEISA-N |
| XLogP | 1.32 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|