C16H13BrN6 — CID 118687485
4-[(3-amino-5-bromoisoquinolin-4-yl)diazenyl]benzenecarboximidamide (PubChem CID 118687485) has the molecular formula C16H13BrN6 and a molecular weight of 369.23 g/mol. Its IUPAC name is 4-[(3-amino-5-bromoisoquinolin-4-yl)diazenyl]benzenecarboximidamide.
| Compound Name | 4-[(3-amino-5-bromoisoquinolin-4-yl)diazenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 118687485 |
| Molecular Formula | C16H13BrN6 |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 4-[(3-amino-5-bromoisoquinolin-4-yl)diazenyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(/N=N/c2c(N)ncc3cccc(Br)c23)cc1 |
| InChI | InChI=1S/C16H13BrN6/c17-12-3-1-2-10-8-21-16(20)14(13(10)12)23-22-11-6-4-9(5-7-11)15(18)19/h1-8H,(H3,18,19)(H2,20,21)/b23-22+ |
| InChIKey | PFTSFBYIVMNAHN-GHVJWSGMSA-N |
| XLogP | 4.28 |
| TPSA | 113.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|