C21H23N5 — CID 158492866
4-[(3-pentylisoquinolin-4-yl)diazenyl]benzenecarboximidamide (PubChem CID 158492866) has the molecular formula C21H23N5 and a molecular weight of 345.45 g/mol. Its IUPAC name is 4-[(3-pentylisoquinolin-4-yl)diazenyl]benzenecarboximidamide.
| Compound Name | 4-[(3-pentylisoquinolin-4-yl)diazenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 158492866 |
| Molecular Formula | C21H23N5 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | 4-[(3-pentylisoquinolin-4-yl)diazenyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(/N=N/c2c(CCCCC)ncc3ccccc23)cc1 |
| InChI | InChI=1S/C21H23N5/c1-2-3-4-9-19-20(18-8-6-5-7-16(18)14-24-19)26-25-17-12-10-15(11-13-17)21(22)23/h5-8,10-14H,2-4,9H2,1H3,(H3,22,23)/b26-25+ |
| InChIKey | UECUYLPGFOYOSK-OCEACIFDSA-N |
| XLogP | 5.67 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|