C23H19BrN6O3 — CID 158391441
(5-amino-3-tritiofuran-2-yl)methyl 2-[6-bromo-4-[(4-carbamimidoylphenyl)diazenyl]isoquinolin-3-yl]acetate (PubChem CID 158391441) has the molecular formula C23H19BrN6O3 and a molecular weight of 509.36 g/mol. Its IUPAC name is (5-amino-3-tritiofuran-2-yl)methyl 2-[6-bromo-4-[(4-carbamimidoylphenyl)diazenyl]isoquinolin-3-yl]acetate.
| Compound Name | (5-amino-3-tritiofuran-2-yl)methyl 2-[6-bromo-4-[(4-carbamimidoylphenyl)diazenyl]isoquinolin-3-yl]acetate |
|---|---|
| PubChem CID | 158391441 |
| Molecular Formula | C23H19BrN6O3 |
| Molecular Weight | 509.36 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | (5-amino-3-tritiofuran-2-yl)methyl 2-[6-bromo-4-[(4-carbamimidoylphenyl)diazenyl]isoquinolin-3-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(/N=N/c2c(CC(=O)OCc3oc(N)cc3[3H])ncc3ccc(Br)cc23)cc1 |
| InChI | InChI=1S/C23H19BrN6O3/c24-15-4-1-14-11-28-19(10-21(31)32-12-17-7-8-20(25)33-17)22(18(14)9-15)30-29-16-5-2-13(3-6-16)23(26)27/h1-9,11H,10,12,25H2,(H3,26,27)/b30-29+/i7T |
| InChIKey | XEEGGVIKAPFEOT-KETGRTEMSA-N |
| XLogP | 5.16 |
| TPSA | 152.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.36 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|