C32H51N7O2 — CID 22056928
4-[2-(4-carbamimidoylphenyl)iminohydrazinyl]benzenecarboximidamide;octadecanoic acid (PubChem CID 22056928) has the molecular formula C32H51N7O2 and a molecular weight of 565.81 g/mol. Its IUPAC name is 4-[2-(4-carbamimidoylphenyl)iminohydrazinyl]benzenecarboximidamide;octadecanoic acid.
| Compound Name | 4-[2-(4-carbamimidoylphenyl)iminohydrazinyl]benzenecarboximidamide;octadecanoic acid |
|---|---|
| PubChem CID | 22056928 |
| Molecular Formula | C32H51N7O2 |
| Molecular Weight | 565.81 g/mol |
| Exact Mass | 565.41 |
| IUPAC Name | 4-[2-(4-carbamimidoylphenyl)iminohydrazinyl]benzenecarboximidamide;octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.[H]/N=C(\N)c1ccc(/N=N/Nc2ccc(/C(N)=N/[H])cc2)cc1 |
| InChI | InChI=1S/C18H36O2.C14H15N7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;15-13(16)9-1-5-11(6-2-9)19-21-20-12-7-3-10(4-8-12)14(17)18/h2-17H2,1H3,(H,19,20);1-8H,(H3,15,16)(H3,17,18)(H,19,20) |
| InChIKey | IHZYXOXYQXDFPG-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 173.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.81 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|