C15H17N7 — CID 169205716
4-[2-(4-carbamimidoylphenyl)iminohydrazinyl]-2-methylbenzenecarboximidamide (PubChem CID 169205716) has the molecular formula C15H17N7 and a molecular weight of 295.35 g/mol. Its IUPAC name is 4-[2-(4-carbamimidoylphenyl)iminohydrazinyl]-2-methylbenzenecarboximidamide.
| Compound Name | 4-[2-(4-carbamimidoylphenyl)iminohydrazinyl]-2-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 169205716 |
| Molecular Formula | C15H17N7 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 4-[2-(4-carbamimidoylphenyl)iminohydrazinyl]-2-methylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(/N=N/Nc2ccc(/C(N)=N/[H])c(C)c2)cc1 |
| InChI | InChI=1S/C15H17N7/c1-9-8-12(6-7-13(9)15(18)19)21-22-20-11-4-2-10(3-5-11)14(16)17/h2-8H,1H3,(H3,16,17)(H3,18,19)(H,20,21) |
| InChIKey | JFJDMWXXHDITDE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 136.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|