C21H17N5 — CID 118687537
4-[2-[2-(2-phenylethynyl)phenyl]iminohydrazinyl]benzenecarboximidamide (PubChem CID 118687537) has the molecular formula C21H17N5 and a molecular weight of 339.40 g/mol. Its IUPAC name is 4-[2-[2-(2-phenylethynyl)phenyl]iminohydrazinyl]benzenecarboximidamide.
| Compound Name | 4-[2-[2-(2-phenylethynyl)phenyl]iminohydrazinyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 118687537 |
| Molecular Formula | C21H17N5 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 4-[2-[2-(2-phenylethynyl)phenyl]iminohydrazinyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N/N=N/c2ccccc2C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H17N5/c22-21(23)18-12-14-19(15-13-18)24-26-25-20-9-5-4-8-17(20)11-10-16-6-2-1-3-7-16/h1-9,12-15H,(H3,22,23)(H,24,25) |
| InChIKey | OMROCRJDRZZINQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|