C13H25NO2 — CID 168926967
3-oxo-N-propyl-N-(2,2,3-trimethylbutyl)propanamide (PubChem CID 168926967) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 3-oxo-N-propyl-N-(2,2,3-trimethylbutyl)propanamide.
| Compound Name | 3-oxo-N-propyl-N-(2,2,3-trimethylbutyl)propanamide |
|---|---|
| PubChem CID | 168926967 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 3-oxo-N-propyl-N-(2,2,3-trimethylbutyl)propanamide |
| SMILES | CCCN(CC(C)(C)C(C)C)C(=O)CC=O |
| InChI | InChI=1S/C13H25NO2/c1-6-8-14(12(16)7-9-15)10-13(4,5)11(2)3/h9,11H,6-8,10H2,1-5H3 |
| InChIKey | WRBCUESFADNONJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|