C20H29NO — CID 168928022
(Z)-3-(2-ethyl-5-methoxyphenyl)-N,N-bis(prop-2-enyl)pent-3-en-1-amine (PubChem CID 168928022) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is (Z)-3-(2-ethyl-5-methoxyphenyl)-N,N-bis(prop-2-enyl)pent-3-en-1-amine.
| Compound Name | (Z)-3-(2-ethyl-5-methoxyphenyl)-N,N-bis(prop-2-enyl)pent-3-en-1-amine |
|---|---|
| PubChem CID | 168928022 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | (Z)-3-(2-ethyl-5-methoxyphenyl)-N,N-bis(prop-2-enyl)pent-3-en-1-amine |
| SMILES | C=CCN(CC=C)CC/C(=C/C)c1cc(OC)ccc1CC |
| InChI | InChI=1S/C20H29NO/c1-6-13-21(14-7-2)15-12-18(9-4)20-16-19(22-5)11-10-17(20)8-3/h6-7,9-11,16H,1-2,8,12-15H2,3-5H3/b18-9- |
| InChIKey | ZLGOPHZFOOHXQY-NVMNQCDNSA-N |
| XLogP | 4.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|