C13H15NO3 — CID 168930983
ethyl 2-[6-(trideuteriomethoxy)-1H-indol-3-yl]acetate (PubChem CID 168930983) has the molecular formula C13H15NO3 and a molecular weight of 236.29 g/mol. Its IUPAC name is ethyl 2-[6-(trideuteriomethoxy)-1H-indol-3-yl]acetate.
| Compound Name | ethyl 2-[6-(trideuteriomethoxy)-1H-indol-3-yl]acetate |
|---|---|
| PubChem CID | 168930983 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | ethyl 2-[6-(trideuteriomethoxy)-1H-indol-3-yl]acetate |
| SMILES | [2H]C([2H])([2H])Oc1ccc2c(CC(=O)OCC)c[nH]c2c1 |
| InChI | InChI=1S/C13H15NO3/c1-3-17-13(15)6-9-8-14-12-7-10(16-2)4-5-11(9)12/h4-5,7-8,14H,3,6H2,1-2H3/i2D3 |
| InChIKey | ZTMZTUTWHBPKRS-BMSJAHLVSA-N |
| XLogP | 2.28 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |