C35H38F3N7O3S — CID 168931668
N-propan-2-yl-2-[[2-[4-[[3-(1-prop-2-enoylpiperidin-3-yl)anilino]methyl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzenesulfonamide (PubChem CID 168931668) has the molecular formula C35H38F3N7O3S and a molecular weight of 693.80 g/mol. Its IUPAC name is N-propan-2-yl-2-[[2-[4-[[3-(1-prop-2-enoylpiperidin-3-yl)anilino]methyl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzenesulfonamide.
| Compound Name | N-propan-2-yl-2-[[2-[4-[[3-(1-prop-2-enoylpiperidin-3-yl)anilino]methyl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 168931668 |
| Molecular Formula | C35H38F3N7O3S |
| Molecular Weight | 693.80 g/mol |
| Exact Mass | 693.27 |
| IUPAC Name | N-propan-2-yl-2-[[2-[4-[[3-(1-prop-2-enoylpiperidin-3-yl)anilino]methyl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzenesulfonamide |
| SMILES | C=CC(=O)N1CCCC(c2cccc(NCc3ccc(Nc4ncc(C(F)(F)F)c(Nc5ccccc5S(=O)(=O)NC(C)C)n4)cc3)c2)C1 |
| InChI | InChI=1S/C35H38F3N7O3S/c1-4-32(46)45-18-8-10-26(22-45)25-9-7-11-28(19-25)39-20-24-14-16-27(17-15-24)41-34-40-21-29(35(36,37)38)33(43-34)42-30-12-5-6-13-31(30)49(47,48)44-23(2)3/h4-7,9,11-17,19,21,23,26,39,44H,1,8,10,18,20,22H2,2-3H3,(H2,40,41,42,43) |
| InChIKey | NUBZJLAEWPBEDD-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 128.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.80 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|