C9H6ClN3O2 — CID 168932695
1-[4-(6-chloropyrimidin-4-yl)-1,3-oxazol-5-yl]ethanone (PubChem CID 168932695) has the molecular formula C9H6ClN3O2 and a molecular weight of 223.62 g/mol. Its IUPAC name is 1-[4-(6-chloropyrimidin-4-yl)-1,3-oxazol-5-yl]ethanone.
| Compound Name | 1-[4-(6-chloropyrimidin-4-yl)-1,3-oxazol-5-yl]ethanone |
|---|---|
| PubChem CID | 168932695 |
| Molecular Formula | C9H6ClN3O2 |
| Molecular Weight | 223.62 g/mol |
| Exact Mass | 223.01 |
| IUPAC Name | 1-[4-(6-chloropyrimidin-4-yl)-1,3-oxazol-5-yl]ethanone |
| SMILES | CC(=O)c1ocnc1-c1cc(Cl)ncn1 |
| InChI | InChI=1S/C9H6ClN3O2/c1-5(14)9-8(13-4-15-9)6-2-7(10)12-3-11-6/h2-4H,1H3 |
| InChIKey | QVYMJDBVMGIYHD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.62 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |