C33H41F3N6O2 — CID 168934324
4-[[2,4-diamino-5-[7-(cyclohexanecarbonylamino)heptyl]-3-pyridinyl]methyl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 168934324) has the molecular formula C33H41F3N6O2 and a molecular weight of 610.73 g/mol. Its IUPAC name is 4-[[2,4-diamino-5-[7-(cyclohexanecarbonylamino)heptyl]-3-pyridinyl]methyl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | 4-[[2,4-diamino-5-[7-(cyclohexanecarbonylamino)heptyl]-3-pyridinyl]methyl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 168934324 |
| Molecular Formula | C33H41F3N6O2 |
| Molecular Weight | 610.73 g/mol |
| Exact Mass | 610.32 |
| IUPAC Name | 4-[[2,4-diamino-5-[7-(cyclohexanecarbonylamino)heptyl]-3-pyridinyl]methyl]-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | Nc1ncc(CCCCCCCNC(=O)C2CCCCC2)c(N)c1Cc1ccc(C(=O)Nc2cc(C(F)(F)F)ccn2)cc1 |
| InChI | InChI=1S/C33H41F3N6O2/c34-33(35,36)26-16-18-39-28(20-26)42-32(44)24-14-12-22(13-15-24)19-27-29(37)25(21-41-30(27)38)11-5-2-1-3-8-17-40-31(43)23-9-6-4-7-10-23/h12-16,18,20-21,23H,1-11,17,19H2,(H,40,43)(H4,37,38,41)(H,39,42,44) |
| InChIKey | XMXKMSQMVINAQI-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.73 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|