C8H14F2N2 — CID 168935644
(Z)-3-(1,1-difluoropropan-2-ylimino)pent-1-en-1-amine (PubChem CID 168935644) has the molecular formula C8H14F2N2 and a molecular weight of 176.21 g/mol. Its IUPAC name is (Z)-3-(1,1-difluoropropan-2-ylimino)pent-1-en-1-amine.
| Compound Name | (Z)-3-(1,1-difluoropropan-2-ylimino)pent-1-en-1-amine |
|---|---|
| PubChem CID | 168935644 |
| Molecular Formula | C8H14F2N2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | (Z)-3-(1,1-difluoropropan-2-ylimino)pent-1-en-1-amine |
| SMILES | CCC(/C=C\N)=N\C(C)C(F)F |
| InChI | InChI=1S/C8H14F2N2/c1-3-7(4-5-11)12-6(2)8(9)10/h4-6,8H,3,11H2,1-2H3/b5-4-,12-7+ |
| InChIKey | FQAOBXMVSWEHAB-HCRNJAACSA-N |
| XLogP | 1.96 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|