C31H48N3O6+ — CID 168936694
4-amino-1-[5-(3-cyclohexyl-3-oxopropyl)oxolan-2-yl]-1-methylpyrimidin-1-ium-2-one;ethane;(Z)-3-ethenyl-4-oxo-2-[(Z)-prop-1-enyl]hex-2-enoic acid (PubChem CID 168936694) has the molecular formula C31H48N3O6+ and a molecular weight of 558.74 g/mol. Its IUPAC name is 4-amino-1-[5-(3-cyclohexyl-3-oxopropyl)oxolan-2-yl]-1-methylpyrimidin-1-ium-2-one;ethane;(Z)-3-ethenyl-4-oxo-2-[(Z)-prop-1-enyl]hex-2-enoic acid.
| Compound Name | 4-amino-1-[5-(3-cyclohexyl-3-oxopropyl)oxolan-2-yl]-1-methylpyrimidin-1-ium-2-one;ethane;(Z)-3-ethenyl-4-oxo-2-[(Z)-prop-1-enyl]hex-2-enoic acid |
|---|---|
| PubChem CID | 168936694 |
| Molecular Formula | C31H48N3O6+ |
| Molecular Weight | 558.74 g/mol |
| Exact Mass | 558.35 |
| IUPAC Name | 4-amino-1-[5-(3-cyclohexyl-3-oxopropyl)oxolan-2-yl]-1-methylpyrimidin-1-ium-2-one;ethane;(Z)-3-ethenyl-4-oxo-2-[(Z)-prop-1-enyl]hex-2-enoic acid |
| SMILES | C=C/C(C(=O)CC)=C(\C=C/C)C(=O)O.CC.C[N+]1(C2CCC(CCC(=O)C3CCCCC3)O2)C=CC(N)=NC1=O |
| InChI | InChI=1S/C18H27N3O3.C11H14O3.C2H6/c1-21(12-11-16(19)20-18(21)23)17-10-8-14(24-17)7-9-15(22)13-5-3-2-4-6-13;1-4-7-9(11(13)14)8(5-2)10(12)6-3;1-2/h11-14,17H,2-10H2,1H3,(H-,19,20,23);4-5,7H,2,6H2,1,3H3,(H,13,14);1-2H3/p+1/b;7-4-,9-8-; |
| InChIKey | GLNIYTVEMPWFJF-NJUWAPBPSA-O |
| XLogP | 6.01 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.74 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|