About 4-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-N-(quinoxalin-6-ylmethyl)pyridin-3-amine
4-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-N-(quinoxalin-6-ylmethyl)pyridin-3-amine (PubChem CID 168937135) has the molecular formula C19H20N6
and a molecular weight of 332.41 g/mol. Its IUPAC name is 4-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-N-(quinoxalin-6-ylmethyl)pyridin-3-amine.
Molecular Properties
| Compound Name | 4-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-N-(quinoxalin-6-ylmethyl)pyridin-3-amine |
| PubChem CID | 168937135 |
| Molecular Formula | C19H20N6 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 4-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-N-(quinoxalin-6-ylmethyl)pyridin-3-amine |
| SMILES | c1cc(N2C3CNCC2C3)c(NCc2ccc3nccnc3c2)cn1 |
| InChI | InChI=1S/C19H20N6/c1-2-16-17(23-6-5-22-16)7-13(1)9-24-18-12-20-4-3-19(18)25-14-8-15(25)11-21-10-14/h1-7,12,14-15,21,24H,8-11H2 |
| InChIKey | DEGWVXUPBVTHBS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-N-(quinoxalin-6-ylmethyl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-N-(quinoxalin-6-ylmethyl)pyridin-3-amine?
The IUPAC name of 4-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-N-(quinoxalin-6-ylmethyl)pyridin-3-amine (CID 168937135) is 4-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-N-(quinoxalin-6-ylmethyl)pyridin-3-amine.
What is the SMILES notation for 4-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-N-(quinoxalin-6-ylmethyl)pyridin-3-amine?
The canonical SMILES for 4-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-N-(quinoxalin-6-ylmethyl)pyridin-3-amine is c1cc(N2C3CNCC2C3)c(NCc2ccc3nccnc3c2)cn1.
What is the InChIKey of 4-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-N-(quinoxalin-6-ylmethyl)pyridin-3-amine?
The InChIKey is DEGWVXUPBVTHBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N6/c1-2-16-17(23-6-5-22-16)7-13(1)9-24-18-12-20-4-3-19(18)25-14-8-15(25)11-21-10-14/h1-7,12,14-15,21,24H,8-11H2.
What are the key properties of 4-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-N-(quinoxalin-6-ylmethyl)pyridin-3-amine?
4-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-N-(quinoxalin-6-ylmethyl)pyridin-3-amine has a molecular weight of 332.41 g/mol, XLogP of 2.19, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-N-(quinoxalin-6-ylmethyl)pyridin-3-amine is sourced from PubChem (CID 168937135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).