C20H24N6 — CID 176561696
5-methyl-4-(4-methylpiperazin-1-yl)-N-(quinoxalin-6-ylmethyl)pyridin-3-amine (PubChem CID 176561696) has the molecular formula C20H24N6 and a molecular weight of 348.45 g/mol. Its IUPAC name is 5-methyl-4-(4-methylpiperazin-1-yl)-N-(quinoxalin-6-ylmethyl)pyridin-3-amine.
| Compound Name | 5-methyl-4-(4-methylpiperazin-1-yl)-N-(quinoxalin-6-ylmethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 176561696 |
| Molecular Formula | C20H24N6 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 5-methyl-4-(4-methylpiperazin-1-yl)-N-(quinoxalin-6-ylmethyl)pyridin-3-amine |
| SMILES | Cc1cncc(NCc2ccc3nccnc3c2)c1N1CCN(C)CC1 |
| InChI | InChI=1S/C20H24N6/c1-15-12-21-14-19(20(15)26-9-7-25(2)8-10-26)24-13-16-3-4-17-18(11-16)23-6-5-22-17/h3-6,11-12,14,24H,7-10,13H2,1-2H3 |
| InChIKey | CXGRHCLQGIMWNS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |