C21H25N5 — CID 166374914
8-methyl-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1,5-naphthyridin-4-amine (PubChem CID 166374914) has the molecular formula C21H25N5 and a molecular weight of 347.47 g/mol. Its IUPAC name is 8-methyl-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1,5-naphthyridin-4-amine.
| Compound Name | 8-methyl-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1,5-naphthyridin-4-amine |
|---|---|
| PubChem CID | 166374914 |
| Molecular Formula | C21H25N5 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 8-methyl-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1,5-naphthyridin-4-amine |
| SMILES | Cc1ccnc2c(NCc3ccc(N4CCN(C)CC4)cc3)ccnc12 |
| InChI | InChI=1S/C21H25N5/c1-16-7-9-23-21-19(8-10-22-20(16)21)24-15-17-3-5-18(6-4-17)26-13-11-25(2)12-14-26/h3-10H,11-15H2,1-2H3,(H,22,24) |
| InChIKey | FNXPNABGYMQIOR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|