C19H20FN5O2 — CID 168937285
N-[(7-fluoroquinoxalin-6-yl)methyl]-5-methoxy-4-[(3R)-pyrrolidin-3-yl]oxypyridin-3-amine (PubChem CID 168937285) has the molecular formula C19H20FN5O2 and a molecular weight of 369.40 g/mol. Its IUPAC name is N-[(7-fluoroquinoxalin-6-yl)methyl]-5-methoxy-4-[(3R)-pyrrolidin-3-yl]oxypyridin-3-amine.
| Compound Name | N-[(7-fluoroquinoxalin-6-yl)methyl]-5-methoxy-4-[(3R)-pyrrolidin-3-yl]oxypyridin-3-amine |
|---|---|
| PubChem CID | 168937285 |
| Molecular Formula | C19H20FN5O2 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | N-[(7-fluoroquinoxalin-6-yl)methyl]-5-methoxy-4-[(3R)-pyrrolidin-3-yl]oxypyridin-3-amine |
| SMILES | COc1cncc(NCc2cc3nccnc3cc2F)c1O[C@@H]1CCNC1 |
| InChI | InChI=1S/C19H20FN5O2/c1-26-18-11-22-10-17(19(18)27-13-2-3-21-9-13)25-8-12-6-15-16(7-14(12)20)24-5-4-23-15/h4-7,10-11,13,21,25H,2-3,8-9H2,1H3/t13-/m1/s1 |
| InChIKey | XKZVLJVSDDNPEG-CYBMUJFWSA-N |
| XLogP | 2.53 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |