C22H23N3O2 — CID 168937620
2-[1-[(3-hydroxy-2,2-dimethylbut-3-enyl)amino]ethenyl]-5-isoquinolin-7-ylpyridin-3-ol (PubChem CID 168937620) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 2-[1-[(3-hydroxy-2,2-dimethylbut-3-enyl)amino]ethenyl]-5-isoquinolin-7-ylpyridin-3-ol.
| Compound Name | 2-[1-[(3-hydroxy-2,2-dimethylbut-3-enyl)amino]ethenyl]-5-isoquinolin-7-ylpyridin-3-ol |
|---|---|
| PubChem CID | 168937620 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 2-[1-[(3-hydroxy-2,2-dimethylbut-3-enyl)amino]ethenyl]-5-isoquinolin-7-ylpyridin-3-ol |
| SMILES | C=C(NCC(C)(C)C(=C)O)c1ncc(-c2ccc3ccncc3c2)cc1O |
| InChI | InChI=1S/C22H23N3O2/c1-14(25-13-22(3,4)15(2)26)21-20(27)10-19(12-24-21)17-6-5-16-7-8-23-11-18(16)9-17/h5-12,25-27H,1-2,13H2,3-4H3 |
| InChIKey | UKXXBWZQTSOMKK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|