C18H26N2O4Si — CID 168937760
ethyl 3-[[3-hydroxy-5-(2-trimethylsilylethynyl)pyridine-2-carbonyl]amino]-2,2-dimethylpropanoate (PubChem CID 168937760) has the molecular formula C18H26N2O4Si and a molecular weight of 362.50 g/mol. Its IUPAC name is ethyl 3-[[3-hydroxy-5-(2-trimethylsilylethynyl)pyridine-2-carbonyl]amino]-2,2-dimethylpropanoate.
| Compound Name | ethyl 3-[[3-hydroxy-5-(2-trimethylsilylethynyl)pyridine-2-carbonyl]amino]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 168937760 |
| Molecular Formula | C18H26N2O4Si |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | ethyl 3-[[3-hydroxy-5-(2-trimethylsilylethynyl)pyridine-2-carbonyl]amino]-2,2-dimethylpropanoate |
| SMILES | CCOC(=O)C(C)(C)CNC(=O)c1ncc(C#C[Si](C)(C)C)cc1O |
| InChI | InChI=1S/C18H26N2O4Si/c1-7-24-17(23)18(2,3)12-20-16(22)15-14(21)10-13(11-19-15)8-9-25(4,5)6/h10-11,21H,7,12H2,1-6H3,(H,20,22) |
| InChIKey | IIAJENIXPYGJNU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|