C17H25NO2Si — CID 156809133
ethyl 2-methyl-2-[4-(2-trimethylsilylethynyl)anilino]propanoate (PubChem CID 156809133) has the molecular formula C17H25NO2Si and a molecular weight of 303.48 g/mol. Its IUPAC name is ethyl 2-methyl-2-[4-(2-trimethylsilylethynyl)anilino]propanoate.
| Compound Name | ethyl 2-methyl-2-[4-(2-trimethylsilylethynyl)anilino]propanoate |
|---|---|
| PubChem CID | 156809133 |
| Molecular Formula | C17H25NO2Si |
| Molecular Weight | 303.48 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | ethyl 2-methyl-2-[4-(2-trimethylsilylethynyl)anilino]propanoate |
| SMILES | CCOC(=O)C(C)(C)Nc1ccc(C#C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C17H25NO2Si/c1-7-20-16(19)17(2,3)18-15-10-8-14(9-11-15)12-13-21(4,5)6/h8-11,18H,7H2,1-6H3 |
| InChIKey | AYHKFCGOOAXYIM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|