C32H32ClN7OS — CID 168938771
1-[4-[4-(3-aminoprop-1-ynyl)phenyl]piperazin-1-yl]-2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]ethanone (PubChem CID 168938771) has the molecular formula C32H32ClN7OS and a molecular weight of 598.18 g/mol. Its IUPAC name is 1-[4-[4-(3-aminoprop-1-ynyl)phenyl]piperazin-1-yl]-2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]ethanone.
| Compound Name | 1-[4-[4-(3-aminoprop-1-ynyl)phenyl]piperazin-1-yl]-2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]ethanone |
|---|---|
| PubChem CID | 168938771 |
| Molecular Formula | C32H32ClN7OS |
| Molecular Weight | 598.18 g/mol |
| Exact Mass | 597.21 |
| IUPAC Name | 1-[4-[4-(3-aminoprop-1-ynyl)phenyl]piperazin-1-yl]-2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]ethanone |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)N1CCN(c3ccc(C#CCN)cc3)CC1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C32H32ClN7OS/c1-20-21(2)42-32-29(20)30(24-8-10-25(33)11-9-24)35-27(31-37-36-22(3)40(31)32)19-28(41)39-17-15-38(16-18-39)26-12-6-23(7-13-26)5-4-14-34/h6-13,27H,14-19,34H2,1-3H3/t27-/m0/s1 |
| InChIKey | NUVPAEGHUYMQEE-MHZLTWQESA-N |
| XLogP | 4.85 |
| TPSA | 92.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.18 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|