C25H28N6O2S — CID 177092957
2-[(9S)-7-[4-(3-aminoprop-1-ynyl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-(2-hydroxyethyl)-N-methylacetamide (PubChem CID 177092957) has the molecular formula C25H28N6O2S and a molecular weight of 476.61 g/mol. Its IUPAC name is 2-[(9S)-7-[4-(3-aminoprop-1-ynyl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-(2-hydroxyethyl)-N-methylacetamide.
| Compound Name | 2-[(9S)-7-[4-(3-aminoprop-1-ynyl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-(2-hydroxyethyl)-N-methylacetamide |
|---|---|
| PubChem CID | 177092957 |
| Molecular Formula | C25H28N6O2S |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 2-[(9S)-7-[4-(3-aminoprop-1-ynyl)phenyl]-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-(2-hydroxyethyl)-N-methylacetamide |
| SMILES | Cc1sc2c(c1C)C(c1ccc(C#CCN)cc1)=N[C@@H](CC(=O)N(C)CCO)c1nnc(C)n1-2 |
| InChI | InChI=1S/C25H28N6O2S/c1-15-16(2)34-25-22(15)23(19-9-7-18(8-10-19)6-5-11-26)27-20(14-21(33)30(4)12-13-32)24-29-28-17(3)31(24)25/h7-10,20,32H,11-14,26H2,1-4H3/t20-/m0/s1 |
| InChIKey | BIAXZLFYAFJSQX-FQEVSTJZSA-N |
| XLogP | 2.30 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|