C32H43ClN6O3S — CID 175711036
butyl N-[6-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]-methylamino]hexyl]-N-methylcarbamate (PubChem CID 175711036) has the molecular formula C32H43ClN6O3S and a molecular weight of 627.26 g/mol. Its IUPAC name is butyl N-[6-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]-methylamino]hexyl]-N-methylcarbamate.
| Compound Name | butyl N-[6-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]-methylamino]hexyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 175711036 |
| Molecular Formula | C32H43ClN6O3S |
| Molecular Weight | 627.26 g/mol |
| Exact Mass | 626.28 |
| IUPAC Name | butyl N-[6-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]-methylamino]hexyl]-N-methylcarbamate |
| SMILES | CCCCOC(=O)N(C)CCCCCCN(C)C(=O)C[C@@H]1N=C(c2ccc(Cl)cc2)c2c(sc(C)c2C)-n2c(C)nnc21 |
| InChI | InChI=1S/C32H43ClN6O3S/c1-7-8-19-42-32(41)38(6)18-12-10-9-11-17-37(5)27(40)20-26-30-36-35-23(4)39(30)31-28(21(2)22(3)43-31)29(34-26)24-13-15-25(33)16-14-24/h13-16,26H,7-12,17-20H2,1-6H3/t26-/m0/s1 |
| InChIKey | LTPAPCLNKHUAJT-SANMLTNESA-N |
| XLogP | 7.08 |
| TPSA | 92.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.26 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|