C24H22N6S2 — CID 177092978
3-[4-[(9S)-4,5,13-trimethyl-9-(1,3-thiazol-2-ylmethyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-7-yl]phenyl]prop-2-yn-1-amine (PubChem CID 177092978) has the molecular formula C24H22N6S2 and a molecular weight of 458.62 g/mol. Its IUPAC name is 3-[4-[(9S)-4,5,13-trimethyl-9-(1,3-thiazol-2-ylmethyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-7-yl]phenyl]prop-2-yn-1-amine.
| Compound Name | 3-[4-[(9S)-4,5,13-trimethyl-9-(1,3-thiazol-2-ylmethyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-7-yl]phenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 177092978 |
| Molecular Formula | C24H22N6S2 |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 3-[4-[(9S)-4,5,13-trimethyl-9-(1,3-thiazol-2-ylmethyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-7-yl]phenyl]prop-2-yn-1-amine |
| SMILES | Cc1sc2c(c1C)C(c1ccc(C#CCN)cc1)=N[C@@H](Cc1nccs1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C24H22N6S2/c1-14-15(2)32-24-21(14)22(18-8-6-17(7-9-18)5-4-10-25)27-19(13-20-26-11-12-31-20)23-29-28-16(3)30(23)24/h6-9,11-12,19H,10,13,25H2,1-3H3/t19-/m0/s1 |
| InChIKey | AXQNQORJVMOJIO-IBGZPJMESA-N |
| XLogP | 4.16 |
| TPSA | 81.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|