C34H34ClN7O3S — CID 172549029
2-(4-aminobut-1-ynyl)-5-[4-[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]piperazin-1-yl]benzoic acid (PubChem CID 172549029) has the molecular formula C34H34ClN7O3S and a molecular weight of 656.21 g/mol. Its IUPAC name is 2-(4-aminobut-1-ynyl)-5-[4-[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]piperazin-1-yl]benzoic acid.
| Compound Name | 2-(4-aminobut-1-ynyl)-5-[4-[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 172549029 |
| Molecular Formula | C34H34ClN7O3S |
| Molecular Weight | 656.21 g/mol |
| Exact Mass | 655.21 |
| IUPAC Name | 2-(4-aminobut-1-ynyl)-5-[4-[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]piperazin-1-yl]benzoic acid |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)N1CCN(c3ccc(C#CCCN)c(C(=O)O)c3)CC1)c1nnc(C)n1-2 |
| InChI | InChI=1S/C34H34ClN7O3S/c1-20-21(2)46-33-30(20)31(24-7-10-25(35)11-8-24)37-28(32-39-38-22(3)42(32)33)19-29(43)41-16-14-40(15-17-41)26-12-9-23(6-4-5-13-36)27(18-26)34(44)45/h7-12,18,28H,5,13-17,19,36H2,1-3H3,(H,44,45)/t28-/m0/s1 |
| InChIKey | BZZOVWLJAWPLFI-NDEPHWFRSA-N |
| XLogP | 4.94 |
| TPSA | 129.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.21 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|