C7H10BrN5 — CID 168939307
N,N'-diamino-6-bromo-2-methylpyridine-3-carboximidamide (PubChem CID 168939307) has the molecular formula C7H10BrN5 and a molecular weight of 244.10 g/mol. Its IUPAC name is N,N'-diamino-6-bromo-2-methylpyridine-3-carboximidamide.
| Compound Name | N,N'-diamino-6-bromo-2-methylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 168939307 |
| Molecular Formula | C7H10BrN5 |
| Molecular Weight | 244.10 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | N,N'-diamino-6-bromo-2-methylpyridine-3-carboximidamide |
| SMILES | Cc1nc(Br)ccc1C(=NN)NN |
| InChI | InChI=1S/C7H10BrN5/c1-4-5(7(12-9)13-10)2-3-6(8)11-4/h2-3H,9-10H2,1H3,(H,12,13) |
| InChIKey | UFEYGFVWWFKNDI-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.10 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|